C17H19BrN4O — CID 113108531
N-(2-bromophenyl)-4-(pyridin-3-ylmethyl)piperazine-1-carboxamide (PubChem CID 113108531) has the molecular formula C17H19BrN4O and a molecular weight of 375.27 g/mol. Its IUPAC name is N-(2-bromophenyl)-4-(pyridin-3-ylmethyl)piperazine-1-carboxamide.
| Compound Name | N-(2-bromophenyl)-4-(pyridin-3-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113108531 |
| Molecular Formula | C17H19BrN4O |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | N-(2-bromophenyl)-4-(pyridin-3-ylmethyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1Br)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C17H19BrN4O/c18-15-5-1-2-6-16(15)20-17(23)22-10-8-21(9-11-22)13-14-4-3-7-19-12-14/h1-7,12H,8-11,13H2,(H,20,23) |
| InChIKey | LBKMJJCEOQNPLQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |