C18H21BrN4O — CID 23993903
N-(2-bromophenyl)-4-(pyridin-3-ylmethyl)-1,4-diazepane-1-carboxamide (PubChem CID 23993903) has the molecular formula C18H21BrN4O and a molecular weight of 389.30 g/mol. Its IUPAC name is N-(2-bromophenyl)-4-(pyridin-3-ylmethyl)-1,4-diazepane-1-carboxamide.
| Compound Name | N-(2-bromophenyl)-4-(pyridin-3-ylmethyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 23993903 |
| Molecular Formula | C18H21BrN4O |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-(2-bromophenyl)-4-(pyridin-3-ylmethyl)-1,4-diazepane-1-carboxamide |
| SMILES | O=C(Nc1ccccc1Br)N1CCCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C18H21BrN4O/c19-16-6-1-2-7-17(16)21-18(24)23-10-4-9-22(11-12-23)14-15-5-3-8-20-13-15/h1-3,5-8,13H,4,9-12,14H2,(H,21,24) |
| InChIKey | VNTNEMGXOOEHJH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |