C16H23N3O4 — CID 159175914
(E)-but-2-enedioic acid;1-ethyl-4-pyridin-3-yl-1,4-diazepane (PubChem CID 159175914) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-ethyl-4-pyridin-3-yl-1,4-diazepane.
| Compound Name | (E)-but-2-enedioic acid;1-ethyl-4-pyridin-3-yl-1,4-diazepane |
|---|---|
| PubChem CID | 159175914 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (E)-but-2-enedioic acid;1-ethyl-4-pyridin-3-yl-1,4-diazepane |
| SMILES | CCN1CCCN(c2cccnc2)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C12H19N3.C4H4O4/c1-2-14-7-4-8-15(10-9-14)12-5-3-6-13-11-12;5-3(6)1-2-4(7)8/h3,5-6,11H,2,4,7-10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | KMGSPUVFXLFJDA-WLHGVMLRSA-N |
| XLogP | 1.33 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|