About 1-ethyl-4-pyridin-3-yl-1,4-diazepane
1-ethyl-4-pyridin-3-yl-1,4-diazepane (PubChem CID 22478498) has the molecular formula C12H19N3
and a molecular weight of 205.31 g/mol. Its IUPAC name is 1-ethyl-4-pyridin-3-yl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-ethyl-4-pyridin-3-yl-1,4-diazepane |
| PubChem CID | 22478498 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 1-ethyl-4-pyridin-3-yl-1,4-diazepane |
| SMILES | CCN1CCCN(c2cccnc2)CC1 |
| InChI | InChI=1S/C12H19N3/c1-2-14-7-4-8-15(10-9-14)12-5-3-6-13-11-12/h3,5-6,11H,2,4,7-10H2,1H3 |
| InChIKey | OJLZKNXSWYJFRQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-4-pyridin-3-yl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-pyridin-3-yl-1,4-diazepane?
The IUPAC name of 1-ethyl-4-pyridin-3-yl-1,4-diazepane (CID 22478498) is 1-ethyl-4-pyridin-3-yl-1,4-diazepane.
What is the SMILES notation for 1-ethyl-4-pyridin-3-yl-1,4-diazepane?
The canonical SMILES for 1-ethyl-4-pyridin-3-yl-1,4-diazepane is CCN1CCCN(c2cccnc2)CC1.
What is the InChIKey of 1-ethyl-4-pyridin-3-yl-1,4-diazepane?
The InChIKey is OJLZKNXSWYJFRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3/c1-2-14-7-4-8-15(10-9-14)12-5-3-6-13-11-12/h3,5-6,11H,2,4,7-10H2,1H3.
What are the key properties of 1-ethyl-4-pyridin-3-yl-1,4-diazepane?
1-ethyl-4-pyridin-3-yl-1,4-diazepane has a molecular weight of 205.31 g/mol, XLogP of 1.61, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-pyridin-3-yl-1,4-diazepane is sourced from PubChem (CID 22478498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).