C12H19N3 — CID 22478498
1-ethyl-4-pyridin-3-yl-1,4-diazepane (PubChem CID 22478498) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is 1-ethyl-4-pyridin-3-yl-1,4-diazepane.
| Compound Name | 1-ethyl-4-pyridin-3-yl-1,4-diazepane |
|---|---|
| PubChem CID | 22478498 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 1-ethyl-4-pyridin-3-yl-1,4-diazepane |
| SMILES | CCN1CCCN(c2cccnc2)CC1 |
| InChI | InChI=1S/C12H19N3/c1-2-14-7-4-8-15(10-9-14)12-5-3-6-13-11-12/h3,5-6,11H,2,4,7-10H2,1H3 |
| InChIKey | OJLZKNXSWYJFRQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |