C13H21N3 — CID 22330011
3-(4-ethyl-1,4-diazepan-1-yl)aniline (PubChem CID 22330011) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 3-(4-ethyl-1,4-diazepan-1-yl)aniline.
| Compound Name | 3-(4-ethyl-1,4-diazepan-1-yl)aniline |
|---|---|
| PubChem CID | 22330011 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 3-(4-ethyl-1,4-diazepan-1-yl)aniline |
| SMILES | CCN1CCCN(c2cccc(N)c2)CC1 |
| InChI | InChI=1S/C13H21N3/c1-2-15-7-4-8-16(10-9-15)13-6-3-5-12(14)11-13/h3,5-6,11H,2,4,7-10,14H2,1H3 |
| InChIKey | PAKODVDHTJZQGT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|