C15H24N4O — CID 79153554
4-(3-aminophenyl)-N,N-diethylpiperazine-1-carboxamide (PubChem CID 79153554) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-(3-aminophenyl)-N,N-diethylpiperazine-1-carboxamide.
| Compound Name | 4-(3-aminophenyl)-N,N-diethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 79153554 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 4-(3-aminophenyl)-N,N-diethylpiperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(c2cccc(N)c2)CC1 |
| InChI | InChI=1S/C15H24N4O/c1-3-17(4-2)15(20)19-10-8-18(9-11-19)14-7-5-6-13(16)12-14/h5-7,12H,3-4,8-11,16H2,1-2H3 |
| InChIKey | IBOOZENAUHHWDF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|