C14H24N4O2S — CID 43461730
4-(3-aminophenyl)-N,N-diethylpiperazine-1-sulfonamide (PubChem CID 43461730) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 4-(3-aminophenyl)-N,N-diethylpiperazine-1-sulfonamide.
| Compound Name | 4-(3-aminophenyl)-N,N-diethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 43461730 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 4-(3-aminophenyl)-N,N-diethylpiperazine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(c2cccc(N)c2)CC1 |
| InChI | InChI=1S/C14H24N4O2S/c1-3-17(4-2)21(19,20)18-10-8-16(9-11-18)14-7-5-6-13(15)12-14/h5-7,12H,3-4,8-11,15H2,1-2H3 |
| InChIKey | USMCLXQCAKCZSX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|