C15H22N4O3S — CID 33324562
4-(1,3-benzoxazol-2-yl)-N,N-diethylpiperazine-1-sulfonamide (PubChem CID 33324562) has the molecular formula C15H22N4O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-N,N-diethylpiperazine-1-sulfonamide.
| Compound Name | 4-(1,3-benzoxazol-2-yl)-N,N-diethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 33324562 |
| Molecular Formula | C15H22N4O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-N,N-diethylpiperazine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C15H22N4O3S/c1-3-18(4-2)23(20,21)19-11-9-17(10-12-19)15-16-13-7-5-6-8-14(13)22-15/h5-8H,3-4,9-12H2,1-2H3 |
| InChIKey | ODJALBAOFAVUHW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |