C13H12N4O — CID 854816
N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzoxazol-2-amine (PubChem CID 854816) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzoxazol-2-amine.
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 854816 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)-1,3-benzoxazol-2-amine |
| SMILES | Cc1cc(C)nc(Nc2nc3ccccc3o2)n1 |
| InChI | InChI=1S/C13H12N4O/c1-8-7-9(2)15-12(14-8)17-13-16-10-5-3-4-6-11(10)18-13/h3-7H,1-2H3,(H,14,15,16,17) |
| InChIKey | FUZSURLWERISAS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |