About 2-Aminobenzoxazole
2-Aminobenzoxazole (PubChem CID 20707) has the molecular formula C7H6N2O
and a molecular weight of 134.14 g/mol. Its IUPAC name is 1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | 2-Aminobenzoxazole |
| PubChem CID | 20707 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 1,3-benzoxazol-2-amine |
| SMILES | C1=CC=C2C(=C1)N=C(O2)N |
| InChI | InChI=1S/C7H6N2O/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H2,8,9) |
| InChIKey | JPBLHOJFMBOCAF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 52.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | 129 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-Aminobenzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Aminobenzoxazole?
The IUPAC name of 2-Aminobenzoxazole (CID 20707) is 1,3-benzoxazol-2-amine.
What is the SMILES notation for 2-Aminobenzoxazole?
The canonical SMILES for 2-Aminobenzoxazole is C1=CC=C2C(=C1)N=C(O2)N.
What is the InChIKey of 2-Aminobenzoxazole?
The InChIKey is JPBLHOJFMBOCAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H2,8,9).
What are the key properties of 2-Aminobenzoxazole?
2-Aminobenzoxazole has a molecular weight of 134.14 g/mol, XLogP of 1.50, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Aminobenzoxazole is sourced from PubChem (CID 20707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).