C9H9NO — CID 23239
2-ethyl-1,3-benzoxazole (PubChem CID 23239) has the molecular formula C9H9NO and a molecular weight of 147.18 g/mol. Its IUPAC name is 2-ethyl-1,3-benzoxazole.
| Compound Name | 2-ethyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 23239 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 2-ethyl-1,3-benzoxazole |
| SMILES | CCc1nc2ccccc2o1 |
| InChI | InChI=1S/C9H9NO/c1-2-9-10-7-5-3-4-6-8(7)11-9/h3-6H,2H2,1H3 |
| InChIKey | YPIFLXOVPCARGI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |