C12H15NO — CID 23425
2-pentyl-1,3-benzoxazole (PubChem CID 23425) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-pentyl-1,3-benzoxazole.
| Compound Name | 2-pentyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 23425 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2-pentyl-1,3-benzoxazole |
| SMILES | CCCCCc1nc2ccccc2o1 |
| InChI | InChI=1S/C12H15NO/c1-2-3-4-9-12-13-10-7-5-6-8-11(10)14-12/h5-8H,2-4,9H2,1H3 |
| InChIKey | VRDOVQBUTHQKPS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|