C16H22ClNO — CID 66460738
2-(2-chlorononyl)-1,3-benzoxazole (PubChem CID 66460738) has the molecular formula C16H22ClNO and a molecular weight of 279.81 g/mol. Its IUPAC name is 2-(2-chlorononyl)-1,3-benzoxazole.
| Compound Name | 2-(2-chlorononyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 66460738 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-(2-chlorononyl)-1,3-benzoxazole |
| SMILES | CCCCCCCC(Cl)Cc1nc2ccccc2o1 |
| InChI | InChI=1S/C16H22ClNO/c1-2-3-4-5-6-9-13(17)12-16-18-14-10-7-8-11-15(14)19-16/h7-8,10-11,13H,2-6,9,12H2,1H3 |
| InChIKey | XCLORXOXSHDPKT-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|