C21H35NOSi — CID 101481618
1-(1,3-benzoxazol-2-yl)octyl-triethylsilane (PubChem CID 101481618) has the molecular formula C21H35NOSi and a molecular weight of 345.60 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)octyl-triethylsilane.
| Compound Name | 1-(1,3-benzoxazol-2-yl)octyl-triethylsilane |
|---|---|
| PubChem CID | 101481618 |
| Molecular Formula | C21H35NOSi |
| Molecular Weight | 345.60 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)octyl-triethylsilane |
| SMILES | CCCCCCCC(c1nc2ccccc2o1)[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H35NOSi/c1-5-9-10-11-12-17-20(24(6-2,7-3)8-4)21-22-18-15-13-14-16-19(18)23-21/h13-16,20H,5-12,17H2,1-4H3 |
| InChIKey | XBSKDQVGGAXIPY-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.60 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|