C12H15NO2 — CID 175319075
2-pentoxy-1,3-benzoxazole (PubChem CID 175319075) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-pentoxy-1,3-benzoxazole.
| Compound Name | 2-pentoxy-1,3-benzoxazole |
|---|---|
| PubChem CID | 175319075 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-pentoxy-1,3-benzoxazole |
| SMILES | CCCCCOc1nc2ccccc2o1 |
| InChI | InChI=1S/C12H15NO2/c1-2-3-6-9-14-12-13-10-7-4-5-8-11(10)15-12/h4-5,7-8H,2-3,6,9H2,1H3 |
| InChIKey | XOOQBDZTGPLOMT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|