C10H9NO3 — CID 57266328
1,3-benzoxazol-2-yl propanoate (PubChem CID 57266328) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 1,3-benzoxazol-2-yl propanoate.
| Compound Name | 1,3-benzoxazol-2-yl propanoate |
|---|---|
| PubChem CID | 57266328 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 1,3-benzoxazol-2-yl propanoate |
| SMILES | CCC(=O)Oc1nc2ccccc2o1 |
| InChI | InChI=1S/C10H9NO3/c1-2-9(12)14-10-11-7-5-3-4-6-8(7)13-10/h3-6H,2H2,1H3 |
| InChIKey | BVAVUCQGANXHOR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |