C11H12N2O3 — CID 47277708
methyl 3-(1,3-benzoxazol-2-ylamino)propanoate (PubChem CID 47277708) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is methyl 3-(1,3-benzoxazol-2-ylamino)propanoate.
| Compound Name | methyl 3-(1,3-benzoxazol-2-ylamino)propanoate |
|---|---|
| PubChem CID | 47277708 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | methyl 3-(1,3-benzoxazol-2-ylamino)propanoate |
| SMILES | COC(=O)CCNc1nc2ccccc2o1 |
| InChI | InChI=1S/C11H12N2O3/c1-15-10(14)6-7-12-11-13-8-4-2-3-5-9(8)16-11/h2-5H,6-7H2,1H3,(H,12,13) |
| InChIKey | DAJLYVDAFQOOOP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |