C11H12N4O2 — CID 103204118
methyl 3-(1,2,4-benzotriazin-3-ylamino)propanoate (PubChem CID 103204118) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is methyl 3-(1,2,4-benzotriazin-3-ylamino)propanoate.
| Compound Name | methyl 3-(1,2,4-benzotriazin-3-ylamino)propanoate |
|---|---|
| PubChem CID | 103204118 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | methyl 3-(1,2,4-benzotriazin-3-ylamino)propanoate |
| SMILES | COC(=O)CCNc1nnc2ccccc2n1 |
| InChI | InChI=1S/C11H12N4O2/c1-17-10(16)6-7-12-11-13-8-4-2-3-5-9(8)14-15-11/h2-5H,6-7H2,1H3,(H,12,13,15) |
| InChIKey | KXZGTWJBDCWRRL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |