C11H15N5 — CID 103203967
N'-(1,2,4-benzotriazin-3-yl)butane-1,4-diamine (PubChem CID 103203967) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is N'-(1,2,4-benzotriazin-3-yl)butane-1,4-diamine.
| Compound Name | N'-(1,2,4-benzotriazin-3-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 103203967 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | N'-(1,2,4-benzotriazin-3-yl)butane-1,4-diamine |
| SMILES | NCCCCNc1nnc2ccccc2n1 |
| InChI | InChI=1S/C11H15N5/c12-7-3-4-8-13-11-14-9-5-1-2-6-10(9)15-16-11/h1-2,5-6H,3-4,7-8,12H2,(H,13,14,16) |
| InChIKey | OAKJJMHPNLSLHO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|