C11H14N4O — CID 103204068
N-(3-methoxypropyl)-1,2,4-benzotriazin-3-amine (PubChem CID 103204068) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is N-(3-methoxypropyl)-1,2,4-benzotriazin-3-amine.
| Compound Name | N-(3-methoxypropyl)-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 103204068 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | N-(3-methoxypropyl)-1,2,4-benzotriazin-3-amine |
| SMILES | COCCCNc1nnc2ccccc2n1 |
| InChI | InChI=1S/C11H14N4O/c1-16-8-4-7-12-11-13-9-5-2-3-6-10(9)14-15-11/h2-3,5-6H,4,7-8H2,1H3,(H,12,13,15) |
| InChIKey | CVFBDLLOZNIBJH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|