C11H12N4 — CID 103204487
N-but-3-enyl-1,2,4-benzotriazin-3-amine (PubChem CID 103204487) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is N-but-3-enyl-1,2,4-benzotriazin-3-amine.
| Compound Name | N-but-3-enyl-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 103204487 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | N-but-3-enyl-1,2,4-benzotriazin-3-amine |
| SMILES | C=CCCNc1nnc2ccccc2n1 |
| InChI | InChI=1S/C11H12N4/c1-2-3-8-12-11-13-9-6-4-5-7-10(9)14-15-11/h2,4-7H,1,3,8H2,(H,12,13,15) |
| InChIKey | LZBKPBQMOQBCSC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|