C16H23N5 — CID 103204756
N'-(1,2,4-benzotriazin-3-yl)-N-cycloheptylethane-1,2-diamine (PubChem CID 103204756) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is N'-(1,2,4-benzotriazin-3-yl)-N-cycloheptylethane-1,2-diamine.
| Compound Name | N'-(1,2,4-benzotriazin-3-yl)-N-cycloheptylethane-1,2-diamine |
|---|---|
| PubChem CID | 103204756 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | N'-(1,2,4-benzotriazin-3-yl)-N-cycloheptylethane-1,2-diamine |
| SMILES | c1ccc2nc(NCCNC3CCCCCC3)nnc2c1 |
| InChI | InChI=1S/C16H23N5/c1-2-4-8-13(7-3-1)17-11-12-18-16-19-14-9-5-6-10-15(14)20-21-16/h5-6,9-10,13,17H,1-4,7-8,11-12H2,(H,18,19,21) |
| InChIKey | DZNHLYBHKXRAAF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|