About N-cyclopropyl-N'-pyrimidin-2-ylethane-1,2-diamine
N-cyclopropyl-N'-pyrimidin-2-ylethane-1,2-diamine (PubChem CID 62663057) has the molecular formula C9H14N4
and a molecular weight of 178.24 g/mol. Its IUPAC name is N-cyclopropyl-N'-pyrimidin-2-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-cyclopropyl-N'-pyrimidin-2-ylethane-1,2-diamine |
| PubChem CID | 62663057 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | N-cyclopropyl-N'-pyrimidin-2-ylethane-1,2-diamine |
| SMILES | c1cnc(NCCNC2CC2)nc1 |
| InChI | InChI=1S/C9H14N4/c1-4-11-9(12-5-1)13-7-6-10-8-2-3-8/h1,4-5,8,10H,2-3,6-7H2,(H,11,12,13) |
| InChIKey | VPJPODNBBDKPQX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-N'-pyrimidin-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N'-pyrimidin-2-ylethane-1,2-diamine?
The IUPAC name of N-cyclopropyl-N'-pyrimidin-2-ylethane-1,2-diamine (CID 62663057) is N-cyclopropyl-N'-pyrimidin-2-ylethane-1,2-diamine.
What is the SMILES notation for N-cyclopropyl-N'-pyrimidin-2-ylethane-1,2-diamine?
The canonical SMILES for N-cyclopropyl-N'-pyrimidin-2-ylethane-1,2-diamine is c1cnc(NCCNC2CC2)nc1.
What is the InChIKey of N-cyclopropyl-N'-pyrimidin-2-ylethane-1,2-diamine?
The InChIKey is VPJPODNBBDKPQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4/c1-4-11-9(12-5-1)13-7-6-10-8-2-3-8/h1,4-5,8,10H,2-3,6-7H2,(H,11,12,13).
What are the key properties of N-cyclopropyl-N'-pyrimidin-2-ylethane-1,2-diamine?
N-cyclopropyl-N'-pyrimidin-2-ylethane-1,2-diamine has a molecular weight of 178.24 g/mol, XLogP of 0.64, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N'-pyrimidin-2-ylethane-1,2-diamine is sourced from PubChem (CID 62663057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).