C14H16BrN3 — CID 106540509
N'-(5-bromoisoquinolin-1-yl)-N-cyclopropylethane-1,2-diamine (PubChem CID 106540509) has the molecular formula C14H16BrN3 and a molecular weight of 306.21 g/mol. Its IUPAC name is N'-(5-bromoisoquinolin-1-yl)-N-cyclopropylethane-1,2-diamine.
| Compound Name | N'-(5-bromoisoquinolin-1-yl)-N-cyclopropylethane-1,2-diamine |
|---|---|
| PubChem CID | 106540509 |
| Molecular Formula | C14H16BrN3 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | N'-(5-bromoisoquinolin-1-yl)-N-cyclopropylethane-1,2-diamine |
| SMILES | Brc1cccc2c(NCCNC3CC3)nccc12 |
| InChI | InChI=1S/C14H16BrN3/c15-13-3-1-2-12-11(13)6-7-17-14(12)18-9-8-16-10-4-5-10/h1-3,6-7,10,16H,4-5,8-9H2,(H,17,18) |
| InChIKey | YPRSGWAJKZUWPD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|