C16H19BrN2O — CID 103888779
2-[[(5-bromoisoquinolin-1-yl)amino]methyl]cyclohexan-1-ol (PubChem CID 103888779) has the molecular formula C16H19BrN2O and a molecular weight of 335.25 g/mol. Its IUPAC name is 2-[[(5-bromoisoquinolin-1-yl)amino]methyl]cyclohexan-1-ol.
| Compound Name | 2-[[(5-bromoisoquinolin-1-yl)amino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 103888779 |
| Molecular Formula | C16H19BrN2O |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-[[(5-bromoisoquinolin-1-yl)amino]methyl]cyclohexan-1-ol |
| SMILES | OC1CCCCC1CNc1nccc2c(Br)cccc12 |
| InChI | InChI=1S/C16H19BrN2O/c17-14-6-3-5-13-12(14)8-9-18-16(13)19-10-11-4-1-2-7-15(11)20/h3,5-6,8-9,11,15,20H,1-2,4,7,10H2,(H,18,19) |
| InChIKey | LSZISUSRQFDFHL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |