C17H20BrClN2 — CID 106542787
5-bromo-N-[[2-(chloromethyl)cyclohexyl]methyl]isoquinolin-1-amine (PubChem CID 106542787) has the molecular formula C17H20BrClN2 and a molecular weight of 367.72 g/mol. Its IUPAC name is 5-bromo-N-[[2-(chloromethyl)cyclohexyl]methyl]isoquinolin-1-amine.
| Compound Name | 5-bromo-N-[[2-(chloromethyl)cyclohexyl]methyl]isoquinolin-1-amine |
|---|---|
| PubChem CID | 106542787 |
| Molecular Formula | C17H20BrClN2 |
| Molecular Weight | 367.72 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 5-bromo-N-[[2-(chloromethyl)cyclohexyl]methyl]isoquinolin-1-amine |
| SMILES | ClCC1CCCCC1CNc1nccc2c(Br)cccc12 |
| InChI | InChI=1S/C17H20BrClN2/c18-16-7-3-6-15-14(16)8-9-20-17(15)21-11-13-5-2-1-4-12(13)10-19/h3,6-9,12-13H,1-2,4-5,10-11H2,(H,20,21) |
| InChIKey | YYRLDELJCBFEJR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.72 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|