C15H21ClN4 — CID 103386425
N-[[2-(chloromethyl)cyclohexyl]methyl]-1-methylimidazo[4,5-c]pyridin-4-amine (PubChem CID 103386425) has the molecular formula C15H21ClN4 and a molecular weight of 292.81 g/mol. Its IUPAC name is N-[[2-(chloromethyl)cyclohexyl]methyl]-1-methylimidazo[4,5-c]pyridin-4-amine.
| Compound Name | N-[[2-(chloromethyl)cyclohexyl]methyl]-1-methylimidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 103386425 |
| Molecular Formula | C15H21ClN4 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | N-[[2-(chloromethyl)cyclohexyl]methyl]-1-methylimidazo[4,5-c]pyridin-4-amine |
| SMILES | Cn1cnc2c(NCC3CCCCC3CCl)nccc21 |
| InChI | InChI=1S/C15H21ClN4/c1-20-10-19-14-13(20)6-7-17-15(14)18-9-12-5-3-2-4-11(12)8-16/h6-7,10-12H,2-5,8-9H2,1H3,(H,17,18) |
| InChIKey | NKSMLZJBIHIHHZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|