C14H20N4O — CID 103385619
N-(2-cyclopentyloxyethyl)-1-methylimidazo[4,5-c]pyridin-4-amine (PubChem CID 103385619) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is N-(2-cyclopentyloxyethyl)-1-methylimidazo[4,5-c]pyridin-4-amine.
| Compound Name | N-(2-cyclopentyloxyethyl)-1-methylimidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 103385619 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | N-(2-cyclopentyloxyethyl)-1-methylimidazo[4,5-c]pyridin-4-amine |
| SMILES | Cn1cnc2c(NCCOC3CCCC3)nccc21 |
| InChI | InChI=1S/C14H20N4O/c1-18-10-17-13-12(18)6-7-15-14(13)16-8-9-19-11-4-2-3-5-11/h6-7,10-11H,2-5,8-9H2,1H3,(H,15,16) |
| InChIKey | ZXOLRTHBHYKSEJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|