C12H14N4 — CID 106222435
1-methyl-N-pent-4-ynylimidazo[4,5-c]pyridin-4-amine (PubChem CID 106222435) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 1-methyl-N-pent-4-ynylimidazo[4,5-c]pyridin-4-amine.
| Compound Name | 1-methyl-N-pent-4-ynylimidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 106222435 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-methyl-N-pent-4-ynylimidazo[4,5-c]pyridin-4-amine |
| SMILES | C#CCCCNc1nccc2c1ncn2C |
| InChI | InChI=1S/C12H14N4/c1-3-4-5-7-13-12-11-10(6-8-14-12)16(2)9-15-11/h1,6,8-9H,4-5,7H2,2H3,(H,13,14) |
| InChIKey | JQWNXUIMMJLSSQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|