C13H18N4O — CID 113446377
2-[(pyrazolo[1,5-a]pyrazin-4-ylamino)methyl]cyclohexan-1-ol (PubChem CID 113446377) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-[(pyrazolo[1,5-a]pyrazin-4-ylamino)methyl]cyclohexan-1-ol.
| Compound Name | 2-[(pyrazolo[1,5-a]pyrazin-4-ylamino)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 113446377 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-[(pyrazolo[1,5-a]pyrazin-4-ylamino)methyl]cyclohexan-1-ol |
| SMILES | OC1CCCCC1CNc1nccn2nccc12 |
| InChI | InChI=1S/C13H18N4O/c18-12-4-2-1-3-10(12)9-15-13-11-5-6-16-17(11)8-7-14-13/h5-8,10,12,18H,1-4,9H2,(H,14,15) |
| InChIKey | CMFAYZCKGLIOCO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |