C12H17N5 — CID 107173671
N-(azepan-4-yl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 107173671) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is N-(azepan-4-yl)pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | N-(azepan-4-yl)pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 107173671 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | N-(azepan-4-yl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | c1cn2nccc2c(NC2CCCNCC2)n1 |
| InChI | InChI=1S/C12H17N5/c1-2-10(3-6-13-5-1)16-12-11-4-7-15-17(11)9-8-14-12/h4,7-10,13H,1-3,5-6H2,(H,14,16) |
| InChIKey | MAHRYZMNNASYKI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |