C16H18N6O — CID 126934365
2-[4-(pyrazolo[1,5-a]pyrazin-4-ylamino)cyclohexyl]pyridazin-3-one (PubChem CID 126934365) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is 2-[4-(pyrazolo[1,5-a]pyrazin-4-ylamino)cyclohexyl]pyridazin-3-one.
| Compound Name | 2-[4-(pyrazolo[1,5-a]pyrazin-4-ylamino)cyclohexyl]pyridazin-3-one |
|---|---|
| PubChem CID | 126934365 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2-[4-(pyrazolo[1,5-a]pyrazin-4-ylamino)cyclohexyl]pyridazin-3-one |
| SMILES | O=c1cccnn1C1CCC(Nc2nccn3nccc23)CC1 |
| InChI | InChI=1S/C16H18N6O/c23-15-2-1-8-19-22(15)13-5-3-12(4-6-13)20-16-14-7-9-18-21(14)11-10-17-16/h1-2,7-13H,3-6H2,(H,17,20) |
| InChIKey | DXIZECZYRSTRKR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |