C10H11ClN4 — CID 104734003
N-(3-chlorocyclobutyl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104734003) has the molecular formula C10H11ClN4 and a molecular weight of 222.68 g/mol. Its IUPAC name is N-(3-chlorocyclobutyl)pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | N-(3-chlorocyclobutyl)pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 104734003 |
| Molecular Formula | C10H11ClN4 |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | N-(3-chlorocyclobutyl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | ClC1CC(Nc2nccn3nccc23)C1 |
| InChI | InChI=1S/C10H11ClN4/c11-7-5-8(6-7)14-10-9-1-2-13-15(9)4-3-12-10/h1-4,7-8H,5-6H2,(H,12,14) |
| InChIKey | UKKUNUOVKVTBGI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|