About N-methyl-N'-pyrazolo[1,5-a]pyrazin-4-ylethane-1,2-diamine
N-methyl-N'-pyrazolo[1,5-a]pyrazin-4-ylethane-1,2-diamine (PubChem CID 104732428) has the molecular formula C9H13N5
and a molecular weight of 191.24 g/mol. Its IUPAC name is N-methyl-N'-pyrazolo[1,5-a]pyrazin-4-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-methyl-N'-pyrazolo[1,5-a]pyrazin-4-ylethane-1,2-diamine |
| PubChem CID | 104732428 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | N-methyl-N'-pyrazolo[1,5-a]pyrazin-4-ylethane-1,2-diamine |
| SMILES | CNCCNc1nccn2nccc12 |
| InChI | InChI=1S/C9H13N5/c1-10-4-5-11-9-8-2-3-13-14(8)7-6-12-9/h2-3,6-7,10H,4-5H2,1H3,(H,11,12) |
| InChIKey | GXCFAUWTYIKGIM-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 54.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N'-pyrazolo[1,5-a]pyrazin-4-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-pyrazolo[1,5-a]pyrazin-4-ylethane-1,2-diamine?
The IUPAC name of N-methyl-N'-pyrazolo[1,5-a]pyrazin-4-ylethane-1,2-diamine (CID 104732428) is N-methyl-N'-pyrazolo[1,5-a]pyrazin-4-ylethane-1,2-diamine.
What is the SMILES notation for N-methyl-N'-pyrazolo[1,5-a]pyrazin-4-ylethane-1,2-diamine?
The canonical SMILES for N-methyl-N'-pyrazolo[1,5-a]pyrazin-4-ylethane-1,2-diamine is CNCCNc1nccn2nccc12.
What is the InChIKey of N-methyl-N'-pyrazolo[1,5-a]pyrazin-4-ylethane-1,2-diamine?
The InChIKey is GXCFAUWTYIKGIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5/c1-10-4-5-11-9-8-2-3-13-14(8)7-6-12-9/h2-3,6-7,10H,4-5H2,1H3,(H,11,12).
What are the key properties of N-methyl-N'-pyrazolo[1,5-a]pyrazin-4-ylethane-1,2-diamine?
N-methyl-N'-pyrazolo[1,5-a]pyrazin-4-ylethane-1,2-diamine has a molecular weight of 191.24 g/mol, XLogP of 0.36, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-pyrazolo[1,5-a]pyrazin-4-ylethane-1,2-diamine is sourced from PubChem (CID 104732428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).