C9H12N4O — CID 104733451
N-methyl-2-pyrazolo[1,5-a]pyrazin-4-yloxyethanamine (PubChem CID 104733451) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is N-methyl-2-pyrazolo[1,5-a]pyrazin-4-yloxyethanamine.
| Compound Name | N-methyl-2-pyrazolo[1,5-a]pyrazin-4-yloxyethanamine |
|---|---|
| PubChem CID | 104733451 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | N-methyl-2-pyrazolo[1,5-a]pyrazin-4-yloxyethanamine |
| SMILES | CNCCOc1nccn2nccc12 |
| InChI | InChI=1S/C9H12N4O/c1-10-5-7-14-9-8-2-3-12-13(8)6-4-11-9/h2-4,6,10H,5,7H2,1H3 |
| InChIKey | HBUARNDZVQFNOX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|