About ethane;4-methylpyrazolo[1,5-a]pyrazine
ethane;4-methylpyrazolo[1,5-a]pyrazine (PubChem CID 145108173) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is ethane;4-methylpyrazolo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | ethane;4-methylpyrazolo[1,5-a]pyrazine |
| PubChem CID | 145108173 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | ethane;4-methylpyrazolo[1,5-a]pyrazine |
| SMILES | CC.Cc1nccn2nccc12 |
| InChI | InChI=1S/C7H7N3.C2H6/c1-6-7-2-3-9-10(7)5-4-8-6;1-2/h2-5H,1H3;1-2H3 |
| InChIKey | AHDBRUVVUJROKI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-methylpyrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methylpyrazolo[1,5-a]pyrazine?
The IUPAC name of ethane;4-methylpyrazolo[1,5-a]pyrazine (CID 145108173) is ethane;4-methylpyrazolo[1,5-a]pyrazine.
What is the SMILES notation for ethane;4-methylpyrazolo[1,5-a]pyrazine?
The canonical SMILES for ethane;4-methylpyrazolo[1,5-a]pyrazine is CC.Cc1nccn2nccc12.
What is the InChIKey of ethane;4-methylpyrazolo[1,5-a]pyrazine?
The InChIKey is AHDBRUVVUJROKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.C2H6/c1-6-7-2-3-9-10(7)5-4-8-6;1-2/h2-5H,1H3;1-2H3.
What are the key properties of ethane;4-methylpyrazolo[1,5-a]pyrazine?
ethane;4-methylpyrazolo[1,5-a]pyrazine has a molecular weight of 163.22 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methylpyrazolo[1,5-a]pyrazine is sourced from PubChem (CID 145108173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).