C11H19N3 — CID 163275224
ethane;8-methylimidazo[1,2-b]pyridazine (PubChem CID 163275224) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is ethane;8-methylimidazo[1,2-b]pyridazine.
| Compound Name | ethane;8-methylimidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 163275224 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | ethane;8-methylimidazo[1,2-b]pyridazine |
| SMILES | CC.CC.Cc1ccnn2ccnc12 |
| InChI | InChI=1S/C7H7N3.2C2H6/c1-6-2-3-9-10-5-4-8-7(6)10;2*1-2/h2-5H,1H3;2*1-2H3 |
| InChIKey | LDTUYTUWVOFPLC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |