C9H9N3O2 — CID 139465945
ethyl imidazo[1,2-b]pyridazine-8-carboxylate (PubChem CID 139465945) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is ethyl imidazo[1,2-b]pyridazine-8-carboxylate.
| Compound Name | ethyl imidazo[1,2-b]pyridazine-8-carboxylate |
|---|---|
| PubChem CID | 139465945 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | ethyl imidazo[1,2-b]pyridazine-8-carboxylate |
| SMILES | CCOC(=O)c1ccnn2ccnc12 |
| InChI | InChI=1S/C9H9N3O2/c1-2-14-9(13)7-3-4-11-12-6-5-10-8(7)12/h3-6H,2H2,1H3 |
| InChIKey | FVWPVBAKIKSYBJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |