About ethyl 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxylate
ethyl 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxylate (PubChem CID 154703458) has the molecular formula C10H11NO4
and a molecular weight of 209.20 g/mol. Its IUPAC name is ethyl 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxylate.
Analyze ethyl 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxylate?
The IUPAC name of ethyl 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxylate (CID 154703458) is ethyl 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxylate.
What is the SMILES notation for ethyl 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxylate?
The canonical SMILES for ethyl 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxylate is CCOC(=O)c1ccnc2c1OCCO2.
What is the InChIKey of ethyl 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxylate?
The InChIKey is NXVLJPKRZULDCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4/c1-2-13-10(12)7-3-4-11-9-8(7)14-5-6-15-9/h3-4H,2,5-6H2,1H3.
What are the key properties of ethyl 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxylate?
ethyl 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxylate has a molecular weight of 209.20 g/mol, XLogP of 1.03, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,3-dihydro-[1,4]dioxino[2,3-b]pyridine-8-carboxylate is sourced from PubChem (CID 154703458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).