C9H9F3N2O2 — CID 118704253
ethyl 3-amino-2-(trifluoromethyl)pyridine-4-carboxylate (PubChem CID 118704253) has the molecular formula C9H9F3N2O2 and a molecular weight of 234.18 g/mol. Its IUPAC name is ethyl 3-amino-2-(trifluoromethyl)pyridine-4-carboxylate.
| Compound Name | ethyl 3-amino-2-(trifluoromethyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 118704253 |
| Molecular Formula | C9H9F3N2O2 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | ethyl 3-amino-2-(trifluoromethyl)pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(C(F)(F)F)c1N |
| InChI | InChI=1S/C9H9F3N2O2/c1-2-16-8(15)5-3-4-14-7(6(5)13)9(10,11)12/h3-4H,2,13H2,1H3 |
| InChIKey | WFAOEXYMJVZYOS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |