C16H17Cl3N4O4 — CID 167658682
ethyl 3-amino-2-chloropyridine-4-carboxylate;ethyl 3-amino-2,6-dichloropyridine-4-carboxylate (PubChem CID 167658682) has the molecular formula C16H17Cl3N4O4 and a molecular weight of 435.70 g/mol. Its IUPAC name is ethyl 3-amino-2-chloropyridine-4-carboxylate;ethyl 3-amino-2,6-dichloropyridine-4-carboxylate.
| Compound Name | ethyl 3-amino-2-chloropyridine-4-carboxylate;ethyl 3-amino-2,6-dichloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 167658682 |
| Molecular Formula | C16H17Cl3N4O4 |
| Molecular Weight | 435.70 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | ethyl 3-amino-2-chloropyridine-4-carboxylate;ethyl 3-amino-2,6-dichloropyridine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(Cl)nc(Cl)c1N.CCOC(=O)c1ccnc(Cl)c1N |
| InChI | InChI=1S/C8H8Cl2N2O2.C8H9ClN2O2/c1-2-14-8(13)4-3-5(9)12-7(10)6(4)11;1-2-13-8(12)5-3-4-11-7(9)6(5)10/h3H,2,11H2,1H3;3-4H,2,10H2,1H3 |
| InChIKey | RQEJIRVMJUQMJN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 130.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.70 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|