C10H12F2N2O3 — CID 82006675
ethyl 3-amino-2-(2,2-difluoroethoxy)pyridine-4-carboxylate (PubChem CID 82006675) has the molecular formula C10H12F2N2O3 and a molecular weight of 246.21 g/mol. Its IUPAC name is ethyl 3-amino-2-(2,2-difluoroethoxy)pyridine-4-carboxylate.
| Compound Name | ethyl 3-amino-2-(2,2-difluoroethoxy)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 82006675 |
| Molecular Formula | C10H12F2N2O3 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | ethyl 3-amino-2-(2,2-difluoroethoxy)pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(OCC(F)F)c1N |
| InChI | InChI=1S/C10H12F2N2O3/c1-2-16-10(15)6-3-4-14-9(8(6)13)17-5-7(11)12/h3-4,7H,2,5,13H2,1H3 |
| InChIKey | ZOJHSFCNROMVCM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |