C12H19N3O2S — CID 112663485
ethyl 3-amino-2-[methyl(2-methylsulfanylethyl)amino]pyridine-4-carboxylate (PubChem CID 112663485) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is ethyl 3-amino-2-[methyl(2-methylsulfanylethyl)amino]pyridine-4-carboxylate.
| Compound Name | ethyl 3-amino-2-[methyl(2-methylsulfanylethyl)amino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 112663485 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | ethyl 3-amino-2-[methyl(2-methylsulfanylethyl)amino]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(N(C)CCSC)c1N |
| InChI | InChI=1S/C12H19N3O2S/c1-4-17-12(16)9-5-6-14-11(10(9)13)15(2)7-8-18-3/h5-6H,4,7-8,13H2,1-3H3 |
| InChIKey | VWLMUMJDKJVIJL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |