C10H16FN3S — CID 105390306
4-(aminomethyl)-3-fluoro-N-methyl-N-(2-methylsulfanylethyl)pyridin-2-amine (PubChem CID 105390306) has the molecular formula C10H16FN3S and a molecular weight of 229.32 g/mol. Its IUPAC name is 4-(aminomethyl)-3-fluoro-N-methyl-N-(2-methylsulfanylethyl)pyridin-2-amine.
| Compound Name | 4-(aminomethyl)-3-fluoro-N-methyl-N-(2-methylsulfanylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105390306 |
| Molecular Formula | C10H16FN3S |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 4-(aminomethyl)-3-fluoro-N-methyl-N-(2-methylsulfanylethyl)pyridin-2-amine |
| SMILES | CSCCN(C)c1nccc(CN)c1F |
| InChI | InChI=1S/C10H16FN3S/c1-14(5-6-15-2)10-9(11)8(7-12)3-4-13-10/h3-4H,5-7,12H2,1-2H3 |
| InChIKey | GAKSHXGAMNLUIA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |