C14H24FN3O2 — CID 105390289
4-(aminomethyl)-N,N-bis(2-ethoxyethyl)-3-fluoropyridin-2-amine (PubChem CID 105390289) has the molecular formula C14H24FN3O2 and a molecular weight of 285.36 g/mol. Its IUPAC name is 4-(aminomethyl)-N,N-bis(2-ethoxyethyl)-3-fluoropyridin-2-amine.
| Compound Name | 4-(aminomethyl)-N,N-bis(2-ethoxyethyl)-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 105390289 |
| Molecular Formula | C14H24FN3O2 |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 4-(aminomethyl)-N,N-bis(2-ethoxyethyl)-3-fluoropyridin-2-amine |
| SMILES | CCOCCN(CCOCC)c1nccc(CN)c1F |
| InChI | InChI=1S/C14H24FN3O2/c1-3-19-9-7-18(8-10-20-4-2)14-13(15)12(11-16)5-6-17-14/h5-6H,3-4,7-11,16H2,1-2H3 |
| InChIKey | YROHEODWHDFPBX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|