C11H16FN3 — CID 105390237
4-(aminomethyl)-N-ethyl-3-fluoro-N-prop-2-enylpyridin-2-amine (PubChem CID 105390237) has the molecular formula C11H16FN3 and a molecular weight of 209.27 g/mol. Its IUPAC name is 4-(aminomethyl)-N-ethyl-3-fluoro-N-prop-2-enylpyridin-2-amine.
| Compound Name | 4-(aminomethyl)-N-ethyl-3-fluoro-N-prop-2-enylpyridin-2-amine |
|---|---|
| PubChem CID | 105390237 |
| Molecular Formula | C11H16FN3 |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 4-(aminomethyl)-N-ethyl-3-fluoro-N-prop-2-enylpyridin-2-amine |
| SMILES | C=CCN(CC)c1nccc(CN)c1F |
| InChI | InChI=1S/C11H16FN3/c1-3-7-15(4-2)11-10(12)9(8-13)5-6-14-11/h3,5-6H,1,4,7-8,13H2,2H3 |
| InChIKey | FMDOAKYQCXHRIW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|