C12H20FN3 — CID 105389049
4-(aminomethyl)-3-fluoro-N-methyl-N-(2-methylbutyl)pyridin-2-amine (PubChem CID 105389049) has the molecular formula C12H20FN3 and a molecular weight of 225.31 g/mol. Its IUPAC name is 4-(aminomethyl)-3-fluoro-N-methyl-N-(2-methylbutyl)pyridin-2-amine.
| Compound Name | 4-(aminomethyl)-3-fluoro-N-methyl-N-(2-methylbutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105389049 |
| Molecular Formula | C12H20FN3 |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 4-(aminomethyl)-3-fluoro-N-methyl-N-(2-methylbutyl)pyridin-2-amine |
| SMILES | CCC(C)CN(C)c1nccc(CN)c1F |
| InChI | InChI=1S/C12H20FN3/c1-4-9(2)8-16(3)12-11(13)10(7-14)5-6-15-12/h5-6,9H,4,7-8,14H2,1-3H3 |
| InChIKey | BWNJYVWURORKRZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |