C13H21FN2 — CID 43314003
2-(aminomethyl)-4-fluoro-N-methyl-N-(2-methylbutyl)aniline (PubChem CID 43314003) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is 2-(aminomethyl)-4-fluoro-N-methyl-N-(2-methylbutyl)aniline.
| Compound Name | 2-(aminomethyl)-4-fluoro-N-methyl-N-(2-methylbutyl)aniline |
|---|---|
| PubChem CID | 43314003 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 2-(aminomethyl)-4-fluoro-N-methyl-N-(2-methylbutyl)aniline |
| SMILES | CCC(C)CN(C)c1ccc(F)cc1CN |
| InChI | InChI=1S/C13H21FN2/c1-4-10(2)9-16(3)13-6-5-12(14)7-11(13)8-15/h5-7,10H,4,8-9,15H2,1-3H3 |
| InChIKey | OEJIFEGMDMYSQV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |