C9H14FN3 — CID 105388980
4-(aminomethyl)-N-ethyl-3-fluoro-N-methylpyridin-2-amine (PubChem CID 105388980) has the molecular formula C9H14FN3 and a molecular weight of 183.23 g/mol. Its IUPAC name is 4-(aminomethyl)-N-ethyl-3-fluoro-N-methylpyridin-2-amine.
| Compound Name | 4-(aminomethyl)-N-ethyl-3-fluoro-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 105388980 |
| Molecular Formula | C9H14FN3 |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | 4-(aminomethyl)-N-ethyl-3-fluoro-N-methylpyridin-2-amine |
| SMILES | CCN(C)c1nccc(CN)c1F |
| InChI | InChI=1S/C9H14FN3/c1-3-13(2)9-8(10)7(6-11)4-5-12-9/h4-5H,3,6,11H2,1-2H3 |
| InChIKey | SMBHBIFTSLWIOX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |