C12H18FN3 — CID 105390426
4-(aminomethyl)-3-fluoro-N-methyl-N-pent-4-enylpyridin-2-amine (PubChem CID 105390426) has the molecular formula C12H18FN3 and a molecular weight of 223.29 g/mol. Its IUPAC name is 4-(aminomethyl)-3-fluoro-N-methyl-N-pent-4-enylpyridin-2-amine.
| Compound Name | 4-(aminomethyl)-3-fluoro-N-methyl-N-pent-4-enylpyridin-2-amine |
|---|---|
| PubChem CID | 105390426 |
| Molecular Formula | C12H18FN3 |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 4-(aminomethyl)-3-fluoro-N-methyl-N-pent-4-enylpyridin-2-amine |
| SMILES | C=CCCCN(C)c1nccc(CN)c1F |
| InChI | InChI=1S/C12H18FN3/c1-3-4-5-8-16(2)12-11(13)10(9-14)6-7-15-12/h3,6-7H,1,4-5,8-9,14H2,2H3 |
| InChIKey | LFDVXUIWJSDWSM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|